About formamide;2-methoxy-1-methyl-4-pentylbenzene
formamide;2-methoxy-1-methyl-4-pentylbenzene (PubChem CID 142217487) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is formamide;2-methoxy-1-methyl-4-pentylbenzene.
Molecular Properties
| Compound Name | formamide;2-methoxy-1-methyl-4-pentylbenzene |
| PubChem CID | 142217487 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | formamide;2-methoxy-1-methyl-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C)c(OC)c1.NC=O |
| InChI | InChI=1S/C13H20O.CH3NO/c1-4-5-6-7-12-9-8-11(2)13(10-12)14-3;2-1-3/h8-10H,4-7H2,1-3H3;1H,(H2,2,3) |
| InChIKey | VHJMAJOGAQHPBO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formamide;2-methoxy-1-methyl-4-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;2-methoxy-1-methyl-4-pentylbenzene?
The IUPAC name of formamide;2-methoxy-1-methyl-4-pentylbenzene (CID 142217487) is formamide;2-methoxy-1-methyl-4-pentylbenzene.
What is the SMILES notation for formamide;2-methoxy-1-methyl-4-pentylbenzene?
The canonical SMILES for formamide;2-methoxy-1-methyl-4-pentylbenzene is CCCCCc1ccc(C)c(OC)c1.NC=O.
What is the InChIKey of formamide;2-methoxy-1-methyl-4-pentylbenzene?
The InChIKey is VHJMAJOGAQHPBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O.CH3NO/c1-4-5-6-7-12-9-8-11(2)13(10-12)14-3;2-1-3/h8-10H,4-7H2,1-3H3;1H,(H2,2,3).
What are the key properties of formamide;2-methoxy-1-methyl-4-pentylbenzene?
formamide;2-methoxy-1-methyl-4-pentylbenzene has a molecular weight of 237.34 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;2-methoxy-1-methyl-4-pentylbenzene is sourced from PubChem (CID 142217487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).