About 2-chloro-4-heptylaniline
2-chloro-4-heptylaniline (PubChem CID 21161447) has the molecular formula C13H20ClN
and a molecular weight of 225.76 g/mol. Its IUPAC name is 2-chloro-4-heptylaniline.
Molecular Properties
| Compound Name | 2-chloro-4-heptylaniline |
| PubChem CID | 21161447 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-chloro-4-heptylaniline |
| SMILES | CCCCCCCc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-2-3-4-5-6-7-11-8-9-13(15)12(14)10-11/h8-10H,2-7,15H2,1H3 |
| InChIKey | OBXYKPTXUMYXBS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-heptylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-heptylaniline?
The IUPAC name of 2-chloro-4-heptylaniline (CID 21161447) is 2-chloro-4-heptylaniline.
What is the SMILES notation for 2-chloro-4-heptylaniline?
The canonical SMILES for 2-chloro-4-heptylaniline is CCCCCCCc1ccc(N)c(Cl)c1.
What is the InChIKey of 2-chloro-4-heptylaniline?
The InChIKey is OBXYKPTXUMYXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN/c1-2-3-4-5-6-7-11-8-9-13(15)12(14)10-11/h8-10H,2-7,15H2,1H3.
What are the key properties of 2-chloro-4-heptylaniline?
2-chloro-4-heptylaniline has a molecular weight of 225.76 g/mol, XLogP of 4.44, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-heptylaniline is sourced from PubChem (CID 21161447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).