C26H18FN — CID 54294239
4-[2-[2-fluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]benzonitrile (PubChem CID 54294239) has the molecular formula C26H18FN and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[2-[2-fluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]benzonitrile.
| Compound Name | 4-[2-[2-fluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 54294239 |
| Molecular Formula | C26H18FN |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[2-[2-fluoro-4-[2-(4-propylphenyl)ethynyl]phenyl]ethynyl]benzonitrile |
| SMILES | CCCc1ccc(C#Cc2ccc(C#Cc3ccc(C#N)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H18FN/c1-2-3-20-4-6-21(7-5-20)8-11-23-15-17-25(26(27)18-23)16-14-22-9-12-24(19-28)13-10-22/h4-7,9-10,12-13,15,17-18H,2-3H2,1H3 |
| InChIKey | RZQYYNKXCNNIJI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|