C26H20F2 — CID 22112209
2-fluoro-1-[2-(3-fluoro-4-methylphenyl)ethynyl]-4-[2-(4-propylphenyl)ethynyl]benzene (PubChem CID 22112209) has the molecular formula C26H20F2 and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-fluoro-1-[2-(3-fluoro-4-methylphenyl)ethynyl]-4-[2-(4-propylphenyl)ethynyl]benzene.
| Compound Name | 2-fluoro-1-[2-(3-fluoro-4-methylphenyl)ethynyl]-4-[2-(4-propylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 22112209 |
| Molecular Formula | C26H20F2 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-fluoro-1-[2-(3-fluoro-4-methylphenyl)ethynyl]-4-[2-(4-propylphenyl)ethynyl]benzene |
| SMILES | CCCc1ccc(C#Cc2ccc(C#Cc3ccc(C)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H20F2/c1-3-4-20-7-9-21(10-8-20)11-12-23-14-16-24(26(28)18-23)15-13-22-6-5-19(2)25(27)17-22/h5-10,14,16-18H,3-4H2,1-2H3 |
| InChIKey | KQMDPKXYKJBTDM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|