C18H17F — CID 123846615
2-fluoro-1-methyl-4-[2-(4-propylphenyl)ethynyl]benzene (PubChem CID 123846615) has the molecular formula C18H17F and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-fluoro-1-methyl-4-[2-(4-propylphenyl)ethynyl]benzene.
| Compound Name | 2-fluoro-1-methyl-4-[2-(4-propylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 123846615 |
| Molecular Formula | C18H17F |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-fluoro-1-methyl-4-[2-(4-propylphenyl)ethynyl]benzene |
| SMILES | CCCc1ccc(C#Cc2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C18H17F/c1-3-4-15-7-9-16(10-8-15)11-12-17-6-5-14(2)18(19)13-17/h5-10,13H,3-4H2,1-2H3 |
| InChIKey | YRFHXAARMBDSSP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|