C30H22F4 — CID 139618170
1,2,4,5-tetrafluoro-3-[4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(4-propylphenyl)benzene (PubChem CID 139618170) has the molecular formula C30H22F4 and a molecular weight of 458.50 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(4-propylphenyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 139618170 |
| Molecular Formula | C30H22F4 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[4-[2-(4-methylphenyl)ethynyl]phenyl]-6-(4-propylphenyl)benzene |
| SMILES | CCCc1ccc(-c2c(F)c(F)c(-c3ccc(C#Cc4ccc(C)cc4)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H22F4/c1-3-4-20-11-15-23(16-12-20)25-27(31)29(33)26(30(34)28(25)32)24-17-13-22(14-18-24)10-9-21-7-5-19(2)6-8-21/h5-8,11-18H,3-4H2,1-2H3 |
| InChIKey | RZGPPSFQXKIJBZ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|