About 1-methyl-4-propylbenzene;molecular fluorine
1-methyl-4-propylbenzene;molecular fluorine (PubChem CID 167533310) has the molecular formula C10H14F8
and a molecular weight of 286.21 g/mol. Its IUPAC name is 1-methyl-4-propylbenzene;molecular fluorine.
Molecular Properties
| Compound Name | 1-methyl-4-propylbenzene;molecular fluorine |
| PubChem CID | 167533310 |
| Molecular Formula | C10H14F8 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-methyl-4-propylbenzene;molecular fluorine |
| SMILES | CCCc1ccc(C)cc1.FF.FF.FF.FF |
| InChI | InChI=1S/C10H14.4F2/c1-3-4-10-7-5-9(2)6-8-10;4*1-2/h5-8H,3-4H2,1-2H3;;;; |
| InChIKey | AGIMDQNJYHEEDU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-propylbenzene;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propylbenzene;molecular fluorine?
The IUPAC name of 1-methyl-4-propylbenzene;molecular fluorine (CID 167533310) is 1-methyl-4-propylbenzene;molecular fluorine.
What is the SMILES notation for 1-methyl-4-propylbenzene;molecular fluorine?
The canonical SMILES for 1-methyl-4-propylbenzene;molecular fluorine is CCCc1ccc(C)cc1.FF.FF.FF.FF.
What is the InChIKey of 1-methyl-4-propylbenzene;molecular fluorine?
The InChIKey is AGIMDQNJYHEEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.4F2/c1-3-4-10-7-5-9(2)6-8-10;4*1-2/h5-8H,3-4H2,1-2H3;;;;.
What are the key properties of 1-methyl-4-propylbenzene;molecular fluorine?
1-methyl-4-propylbenzene;molecular fluorine has a molecular weight of 286.21 g/mol, XLogP of 6.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propylbenzene;molecular fluorine is sourced from PubChem (CID 167533310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).