About ethane;formamide;1-methyl-4-propylbenzene
ethane;formamide;1-methyl-4-propylbenzene (PubChem CID 143471754) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;formamide;1-methyl-4-propylbenzene.
Molecular Properties
| Compound Name | ethane;formamide;1-methyl-4-propylbenzene |
| PubChem CID | 143471754 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;formamide;1-methyl-4-propylbenzene |
| SMILES | CC.CCCc1ccc(C)cc1.NC=O |
| InChI | InChI=1S/C10H14.C2H6.CH3NO/c1-3-4-10-7-5-9(2)6-8-10;1-2;2-1-3/h5-8H,3-4H2,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | DATGNYLOLCPDTE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formamide;1-methyl-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formamide;1-methyl-4-propylbenzene?
The IUPAC name of ethane;formamide;1-methyl-4-propylbenzene (CID 143471754) is ethane;formamide;1-methyl-4-propylbenzene.
What is the SMILES notation for ethane;formamide;1-methyl-4-propylbenzene?
The canonical SMILES for ethane;formamide;1-methyl-4-propylbenzene is CC.CCCc1ccc(C)cc1.NC=O.
What is the InChIKey of ethane;formamide;1-methyl-4-propylbenzene?
The InChIKey is DATGNYLOLCPDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C2H6.CH3NO/c1-3-4-10-7-5-9(2)6-8-10;1-2;2-1-3/h5-8H,3-4H2,1-2H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;formamide;1-methyl-4-propylbenzene?
ethane;formamide;1-methyl-4-propylbenzene has a molecular weight of 209.33 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formamide;1-methyl-4-propylbenzene is sourced from PubChem (CID 143471754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).