About ethane;2-methylpropane;1-methyl-4-propylbenzene
ethane;2-methylpropane;1-methyl-4-propylbenzene (PubChem CID 142174844) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is ethane;2-methylpropane;1-methyl-4-propylbenzene.
Molecular Properties
| Compound Name | ethane;2-methylpropane;1-methyl-4-propylbenzene |
| PubChem CID | 142174844 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | ethane;2-methylpropane;1-methyl-4-propylbenzene |
| SMILES | CC.CC(C)C.CCCc1ccc(C)cc1 |
| InChI | InChI=1S/C10H14.C4H10.C2H6/c1-3-4-10-7-5-9(2)6-8-10;1-4(2)3;1-2/h5-8H,3-4H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | VBKXASOBNFQBQX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylpropane;1-methyl-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;1-methyl-4-propylbenzene?
The IUPAC name of ethane;2-methylpropane;1-methyl-4-propylbenzene (CID 142174844) is ethane;2-methylpropane;1-methyl-4-propylbenzene.
What is the SMILES notation for ethane;2-methylpropane;1-methyl-4-propylbenzene?
The canonical SMILES for ethane;2-methylpropane;1-methyl-4-propylbenzene is CC.CC(C)C.CCCc1ccc(C)cc1.
What is the InChIKey of ethane;2-methylpropane;1-methyl-4-propylbenzene?
The InChIKey is VBKXASOBNFQBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C4H10.C2H6/c1-3-4-10-7-5-9(2)6-8-10;1-4(2)3;1-2/h5-8H,3-4H2,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;1-methyl-4-propylbenzene?
ethane;2-methylpropane;1-methyl-4-propylbenzene has a molecular weight of 222.42 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;1-methyl-4-propylbenzene is sourced from PubChem (CID 142174844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).