C30H42 — CID 159106327
1-butyl-4-methylbenzene;1-ethyl-4-methylbenzene;1-methyl-4-propylbenzene (PubChem CID 159106327) has the molecular formula C30H42 and a molecular weight of 402.67 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;1-ethyl-4-methylbenzene;1-methyl-4-propylbenzene.
| Compound Name | 1-butyl-4-methylbenzene;1-ethyl-4-methylbenzene;1-methyl-4-propylbenzene |
|---|---|
| PubChem CID | 159106327 |
| Molecular Formula | C30H42 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | 1-butyl-4-methylbenzene;1-ethyl-4-methylbenzene;1-methyl-4-propylbenzene |
| SMILES | CCCCc1ccc(C)cc1.CCCc1ccc(C)cc1.CCc1ccc(C)cc1 |
| InChI | InChI=1S/C11H16.C10H14.C9H12/c1-3-4-5-11-8-6-10(2)7-9-11;1-3-4-10-7-5-9(2)6-8-10;1-3-9-6-4-8(2)5-7-9/h6-9H,3-5H2,1-2H3;5-8H,3-4H2,1-2H3;4-7H,3H2,1-2H3 |
| InChIKey | KDXWYMJJXWHNIE-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |