About 1-butyl-4-methylbenzene;trifluoroalumane
1-butyl-4-methylbenzene;trifluoroalumane (PubChem CID 175081213) has the molecular formula C11H16AlF3
and a molecular weight of 232.23 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;trifluoroalumane.
Molecular Properties
| Compound Name | 1-butyl-4-methylbenzene;trifluoroalumane |
| PubChem CID | 175081213 |
| Molecular Formula | C11H16AlF3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-butyl-4-methylbenzene;trifluoroalumane |
| SMILES | CCCCc1ccc(C)cc1.F[Al](F)F |
| InChI | InChI=1S/C11H16.Al.3FH/c1-3-4-5-11-8-6-10(2)7-9-11;;;;/h6-9H,3-5H2,1-2H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | AWZZIRPQPUZYNP-UHFFFAOYSA-K |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-methylbenzene;trifluoroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methylbenzene;trifluoroalumane?
The IUPAC name of 1-butyl-4-methylbenzene;trifluoroalumane (CID 175081213) is 1-butyl-4-methylbenzene;trifluoroalumane.
What is the SMILES notation for 1-butyl-4-methylbenzene;trifluoroalumane?
The canonical SMILES for 1-butyl-4-methylbenzene;trifluoroalumane is CCCCc1ccc(C)cc1.F[Al](F)F.
What is the InChIKey of 1-butyl-4-methylbenzene;trifluoroalumane?
The InChIKey is AWZZIRPQPUZYNP-UHFFFAOYSA-K. The full InChI is InChI=1S/C11H16.Al.3FH/c1-3-4-5-11-8-6-10(2)7-9-11;;;;/h6-9H,3-5H2,1-2H3;;3*1H/q;+3;;;/p-3.
What are the key properties of 1-butyl-4-methylbenzene;trifluoroalumane?
1-butyl-4-methylbenzene;trifluoroalumane has a molecular weight of 232.23 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylbenzene;trifluoroalumane is sourced from PubChem (CID 175081213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).