About carbon dioxide;1-methyl-4-pentylbenzene
carbon dioxide;1-methyl-4-pentylbenzene (PubChem CID 161302666) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is carbon dioxide;1-methyl-4-pentylbenzene.
Molecular Properties
| Compound Name | carbon dioxide;1-methyl-4-pentylbenzene |
| PubChem CID | 161302666 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | carbon dioxide;1-methyl-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C)cc1.O=C=O |
| InChI | InChI=1S/C12H18.CO2/c1-3-4-5-6-12-9-7-11(2)8-10-12;2-1-3/h7-10H,3-6H2,1-2H3; |
| InChIKey | VHVCYXUEFLXXES-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;1-methyl-4-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-methyl-4-pentylbenzene?
The IUPAC name of carbon dioxide;1-methyl-4-pentylbenzene (CID 161302666) is carbon dioxide;1-methyl-4-pentylbenzene.
What is the SMILES notation for carbon dioxide;1-methyl-4-pentylbenzene?
The canonical SMILES for carbon dioxide;1-methyl-4-pentylbenzene is CCCCCc1ccc(C)cc1.O=C=O.
What is the InChIKey of carbon dioxide;1-methyl-4-pentylbenzene?
The InChIKey is VHVCYXUEFLXXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.CO2/c1-3-4-5-6-12-9-7-11(2)8-10-12;2-1-3/h7-10H,3-6H2,1-2H3;.
What are the key properties of carbon dioxide;1-methyl-4-pentylbenzene?
carbon dioxide;1-methyl-4-pentylbenzene has a molecular weight of 206.28 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-methyl-4-pentylbenzene is sourced from PubChem (CID 161302666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).