carbon dioxide;1-methyl-4-pentylbenzene

C13H18O2 — CID 161302666

IUPACcarbon dioxide;1-methyl-4-pentylbenzene
SMILESCCCCCc1ccc(C)cc1.O=C=O
InChIInChI=1S/C12H18.CO2/c1-3-4-5-6-12-9-7-11(2)8-10-12;2-1-3/h7-10H,3-6H2,1-2H3;
InChIKeyVHVCYXUEFLXXES-UHFFFAOYSA-N
MW206.28 g/mol
LogP3.14
Rot. Bonds4

About carbon dioxide;1-methyl-4-pentylbenzene

carbon dioxide;1-methyl-4-pentylbenzene (PubChem CID 161302666) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is carbon dioxide;1-methyl-4-pentylbenzene.

Molecular Properties

Compound Namecarbon dioxide;1-methyl-4-pentylbenzene
PubChem CID161302666
Molecular FormulaC13H18O2
Molecular Weight206.28 g/mol
Exact Mass206.13
IUPAC Namecarbon dioxide;1-methyl-4-pentylbenzene
SMILESCCCCCc1ccc(C)cc1.O=C=O
InChIInChI=1S/C12H18.CO2/c1-3-4-5-6-12-9-7-11(2)8-10-12;2-1-3/h7-10H,3-6H2,1-2H3;
InChIKeyVHVCYXUEFLXXES-UHFFFAOYSA-N
XLogP3.14
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.28
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze carbon dioxide;1-methyl-4-pentylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;1-methyl-4-pentylbenzene?
The IUPAC name of carbon dioxide;1-methyl-4-pentylbenzene (CID 161302666) is carbon dioxide;1-methyl-4-pentylbenzene.
What is the SMILES notation for carbon dioxide;1-methyl-4-pentylbenzene?
The canonical SMILES for carbon dioxide;1-methyl-4-pentylbenzene is CCCCCc1ccc(C)cc1.O=C=O.
What is the InChIKey of carbon dioxide;1-methyl-4-pentylbenzene?
The InChIKey is VHVCYXUEFLXXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.CO2/c1-3-4-5-6-12-9-7-11(2)8-10-12;2-1-3/h7-10H,3-6H2,1-2H3;.
What are the key properties of carbon dioxide;1-methyl-4-pentylbenzene?
carbon dioxide;1-methyl-4-pentylbenzene has a molecular weight of 206.28 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-methyl-4-pentylbenzene is sourced from PubChem (CID 161302666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).