About cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene
cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene (PubChem CID 161488125) has the molecular formula C24H36
and a molecular weight of 324.55 g/mol. Its IUPAC name is cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene.
Molecular Properties
| Compound Name | cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene |
| PubChem CID | 161488125 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene |
| SMILES | C1CC1.CCCCCc1ccc(C)cc1.CCc1ccc(C)cc1 |
| InChI | InChI=1S/C12H18.C9H12.C3H6/c1-3-4-5-6-12-9-7-11(2)8-10-12;1-3-9-6-4-8(2)5-7-9;1-2-3-1/h7-10H,3-6H2,1-2H3;4-7H,3H2,1-2H3;1-3H2 |
| InChIKey | WFFWMLVJYVMDTE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene?
The IUPAC name of cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene (CID 161488125) is cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene.
What is the SMILES notation for cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene?
The canonical SMILES for cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene is C1CC1.CCCCCc1ccc(C)cc1.CCc1ccc(C)cc1.
What is the InChIKey of cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene?
The InChIKey is WFFWMLVJYVMDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C9H12.C3H6/c1-3-4-5-6-12-9-7-11(2)8-10-12;1-3-9-6-4-8(2)5-7-9;1-2-3-1/h7-10H,3-6H2,1-2H3;4-7H,3H2,1-2H3;1-3H2.
What are the key properties of cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene?
cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene has a molecular weight of 324.55 g/mol, XLogP of 7.46, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;1-ethyl-4-methylbenzene;1-methyl-4-pentylbenzene is sourced from PubChem (CID 161488125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).