About 1-methyl-4-pentylbenzene;sulfuryl dichloride
1-methyl-4-pentylbenzene;sulfuryl dichloride (PubChem CID 174918567) has the molecular formula C12H18Cl2O2S
and a molecular weight of 297.25 g/mol. Its IUPAC name is 1-methyl-4-pentylbenzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-methyl-4-pentylbenzene;sulfuryl dichloride |
| PubChem CID | 174918567 |
| Molecular Formula | C12H18Cl2O2S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-methyl-4-pentylbenzene;sulfuryl dichloride |
| SMILES | CCCCCc1ccc(C)cc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C12H18.Cl2O2S/c1-3-4-5-6-12-9-7-11(2)8-10-12;1-5(2,3)4/h7-10H,3-6H2,1-2H3; |
| InChIKey | UDWLLNJQSMDCMH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-pentylbenzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-pentylbenzene;sulfuryl dichloride?
The IUPAC name of 1-methyl-4-pentylbenzene;sulfuryl dichloride (CID 174918567) is 1-methyl-4-pentylbenzene;sulfuryl dichloride.
What is the SMILES notation for 1-methyl-4-pentylbenzene;sulfuryl dichloride?
The canonical SMILES for 1-methyl-4-pentylbenzene;sulfuryl dichloride is CCCCCc1ccc(C)cc1.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-methyl-4-pentylbenzene;sulfuryl dichloride?
The InChIKey is UDWLLNJQSMDCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.Cl2O2S/c1-3-4-5-6-12-9-7-11(2)8-10-12;1-5(2,3)4/h7-10H,3-6H2,1-2H3;.
What are the key properties of 1-methyl-4-pentylbenzene;sulfuryl dichloride?
1-methyl-4-pentylbenzene;sulfuryl dichloride has a molecular weight of 297.25 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-pentylbenzene;sulfuryl dichloride is sourced from PubChem (CID 174918567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).