About 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium
4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium (PubChem CID 172776115) has the molecular formula C40H52O3S2
and a molecular weight of 644.99 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium |
| PubChem CID | 172776115 |
| Molecular Formula | C40H52O3S2 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium |
| SMILES | CCCCCc1ccc([S+](c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C33H45S.C7H8O3S/c1-4-7-10-13-28-16-22-31(23-17-28)34(32-24-18-29(19-25-32)14-11-8-5-2)33-26-20-30(21-27-33)15-12-9-6-3;1-6-2-4-7(5-3-6)11(8,9)10/h16-27H,4-15H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | NPRWLOCYYVHBCM-UHFFFAOYSA-M |
| XLogP | 10.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium?
The IUPAC name of 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium (CID 172776115) is 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium.
What is the SMILES notation for 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium?
The canonical SMILES for 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium is CCCCCc1ccc([S+](c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium?
The InChIKey is NPRWLOCYYVHBCM-UHFFFAOYSA-M. The full InChI is InChI=1S/C33H45S.C7H8O3S/c1-4-7-10-13-28-16-22-31(23-17-28)34(32-24-18-29(19-25-32)14-11-8-5-2)33-26-20-30(21-27-33)15-12-9-6-3;1-6-2-4-7(5-3-6)11(8,9)10/h16-27H,4-15H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium?
4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium has a molecular weight of 644.99 g/mol, XLogP of 10.88, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;tris(4-pentylphenyl)sulfanium is sourced from PubChem (CID 172776115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).