1-butyl-4-methylbenzene;formic acid

C12H18O2 — CID 177221373

IUPAC1-butyl-4-methylbenzene;formic acid
SMILESCCCCc1ccc(C)cc1.O=CO
InChIInChI=1S/C11H16.CH2O2/c1-3-4-5-11-8-6-10(2)7-9-11;2-1-3/h6-9H,3-5H2,1-2H3;1H,(H,2,3)
InChIKeyUJUWZJMVNIRKMN-UHFFFAOYSA-N
MW194.27 g/mol
LogP3.04
Rot. Bonds3

About 1-butyl-4-methylbenzene;formic acid

1-butyl-4-methylbenzene;formic acid (PubChem CID 177221373) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;formic acid.

Molecular Properties

Compound Name1-butyl-4-methylbenzene;formic acid
PubChem CID177221373
Molecular FormulaC12H18O2
Molecular Weight194.27 g/mol
Exact Mass194.13
IUPAC Name1-butyl-4-methylbenzene;formic acid
SMILESCCCCc1ccc(C)cc1.O=CO
InChIInChI=1S/C11H16.CH2O2/c1-3-4-5-11-8-6-10(2)7-9-11;2-1-3/h6-9H,3-5H2,1-2H3;1H,(H,2,3)
InChIKeyUJUWZJMVNIRKMN-UHFFFAOYSA-N
XLogP3.04
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.27
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1-butyl-4-methylbenzene;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butyl-4-methylbenzene;formic acid?
The IUPAC name of 1-butyl-4-methylbenzene;formic acid (CID 177221373) is 1-butyl-4-methylbenzene;formic acid.
What is the SMILES notation for 1-butyl-4-methylbenzene;formic acid?
The canonical SMILES for 1-butyl-4-methylbenzene;formic acid is CCCCc1ccc(C)cc1.O=CO.
What is the InChIKey of 1-butyl-4-methylbenzene;formic acid?
The InChIKey is UJUWZJMVNIRKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.CH2O2/c1-3-4-5-11-8-6-10(2)7-9-11;2-1-3/h6-9H,3-5H2,1-2H3;1H,(H,2,3).
What are the key properties of 1-butyl-4-methylbenzene;formic acid?
1-butyl-4-methylbenzene;formic acid has a molecular weight of 194.27 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylbenzene;formic acid is sourced from PubChem (CID 177221373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).