About 1-butyl-4-methylbenzene;N-methylmethanamine
1-butyl-4-methylbenzene;N-methylmethanamine (PubChem CID 143818952) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;N-methylmethanamine.
Molecular Properties
| Compound Name | 1-butyl-4-methylbenzene;N-methylmethanamine |
| PubChem CID | 143818952 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1-butyl-4-methylbenzene;N-methylmethanamine |
| SMILES | CCCCc1ccc(C)cc1.CNC |
| InChI | InChI=1S/C11H16.C2H7N/c1-3-4-5-11-8-6-10(2)7-9-11;1-3-2/h6-9H,3-5H2,1-2H3;3H,1-2H3 |
| InChIKey | XQJAXKUEHJDGDB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-4-methylbenzene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methylbenzene;N-methylmethanamine?
The IUPAC name of 1-butyl-4-methylbenzene;N-methylmethanamine (CID 143818952) is 1-butyl-4-methylbenzene;N-methylmethanamine.
What is the SMILES notation for 1-butyl-4-methylbenzene;N-methylmethanamine?
The canonical SMILES for 1-butyl-4-methylbenzene;N-methylmethanamine is CCCCc1ccc(C)cc1.CNC.
What is the InChIKey of 1-butyl-4-methylbenzene;N-methylmethanamine?
The InChIKey is XQJAXKUEHJDGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C2H7N/c1-3-4-5-11-8-6-10(2)7-9-11;1-3-2/h6-9H,3-5H2,1-2H3;3H,1-2H3.
What are the key properties of 1-butyl-4-methylbenzene;N-methylmethanamine?
1-butyl-4-methylbenzene;N-methylmethanamine has a molecular weight of 193.33 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methylbenzene;N-methylmethanamine is sourced from PubChem (CID 143818952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).