About 1-methyl-4-propylbenzene;trifluoroalumane
1-methyl-4-propylbenzene;trifluoroalumane (PubChem CID 174704537) has the molecular formula C10H14AlF3
and a molecular weight of 218.20 g/mol. Its IUPAC name is 1-methyl-4-propylbenzene;trifluoroalumane.
Molecular Properties
| Compound Name | 1-methyl-4-propylbenzene;trifluoroalumane |
| PubChem CID | 174704537 |
| Molecular Formula | C10H14AlF3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-methyl-4-propylbenzene;trifluoroalumane |
| SMILES | CCCc1ccc(C)cc1.F[Al](F)F |
| InChI | InChI=1S/C10H14.Al.3FH/c1-3-4-10-7-5-9(2)6-8-10;;;;/h5-8H,3-4H2,1-2H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | BIICQHLDCYRWBX-UHFFFAOYSA-K |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-propylbenzene;trifluoroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propylbenzene;trifluoroalumane?
The IUPAC name of 1-methyl-4-propylbenzene;trifluoroalumane (CID 174704537) is 1-methyl-4-propylbenzene;trifluoroalumane.
What is the SMILES notation for 1-methyl-4-propylbenzene;trifluoroalumane?
The canonical SMILES for 1-methyl-4-propylbenzene;trifluoroalumane is CCCc1ccc(C)cc1.F[Al](F)F.
What is the InChIKey of 1-methyl-4-propylbenzene;trifluoroalumane?
The InChIKey is BIICQHLDCYRWBX-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H14.Al.3FH/c1-3-4-10-7-5-9(2)6-8-10;;;;/h5-8H,3-4H2,1-2H3;;3*1H/q;+3;;;/p-3.
What are the key properties of 1-methyl-4-propylbenzene;trifluoroalumane?
1-methyl-4-propylbenzene;trifluoroalumane has a molecular weight of 218.20 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propylbenzene;trifluoroalumane is sourced from PubChem (CID 174704537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).