About 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene
1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene (PubChem CID 143481088) has the molecular formula C28H28
and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene.
Molecular Properties
| Compound Name | 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene |
| PubChem CID | 143481088 |
| Molecular Formula | C28H28 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene |
| SMILES | CCCc1ccc(-c2ccccc2)cc1.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16.C13H12/c1-2-6-13-9-11-15(12-10-13)14-7-4-3-5-8-14;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h3-5,7-12H,2,6H2,1H3;2-10H,1H3 |
| InChIKey | RFZJSGSPJTYDNA-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene?
The IUPAC name of 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene (CID 143481088) is 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene.
What is the SMILES notation for 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene?
The canonical SMILES for 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene is CCCc1ccc(-c2ccccc2)cc1.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene?
The InChIKey is RFZJSGSPJTYDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C13H12/c1-2-6-13-9-11-15(12-10-13)14-7-4-3-5-8-14;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h3-5,7-12H,2,6H2,1H3;2-10H,1H3.
What are the key properties of 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene?
1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene has a molecular weight of 364.53 g/mol, XLogP of 7.97, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenylbenzene;1-phenyl-4-propylbenzene is sourced from PubChem (CID 143481088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).