About ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene
ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene (PubChem CID 144519167) has the molecular formula C28H38
and a molecular weight of 374.61 g/mol. Its IUPAC name is ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene.
Molecular Properties
| Compound Name | ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene |
| PubChem CID | 144519167 |
| Molecular Formula | C28H38 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene |
| SMILES | CC.CCC(C)C.CCCc1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H20.C5H12.C2H6/c1-2-6-17-9-11-19(12-10-17)21-15-13-20(14-16-21)18-7-4-3-5-8-18;1-4-5(2)3;1-2/h3-5,7-16H,2,6H2,1H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | YFQNXDBMKNDQQB-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene?
The IUPAC name of ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene (CID 144519167) is ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene.
What is the SMILES notation for ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene?
The canonical SMILES for ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene is CC.CCC(C)C.CCCc1ccc(-c2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene?
The InChIKey is YFQNXDBMKNDQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20.C5H12.C2H6/c1-2-6-17-9-11-19(12-10-17)21-15-13-20(14-16-21)18-7-4-3-5-8-18;1-4-5(2)3;1-2/h3-5,7-16H,2,6H2,1H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene?
ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene has a molecular weight of 374.61 g/mol, XLogP of 9.05, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;1-phenyl-4-(4-propylphenyl)benzene is sourced from PubChem (CID 144519167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).