About 1-butyl-4-phenylbenzene;ethane
1-butyl-4-phenylbenzene;ethane (PubChem CID 143743409) has the molecular formula C22H36
and a molecular weight of 300.53 g/mol. Its IUPAC name is 1-butyl-4-phenylbenzene;ethane.
Molecular Properties
| Compound Name | 1-butyl-4-phenylbenzene;ethane |
| PubChem CID | 143743409 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 1-butyl-4-phenylbenzene;ethane |
| SMILES | CC.CC.CC.CCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18.3C2H6/c1-2-3-7-14-10-12-16(13-11-14)15-8-5-4-6-9-15;3*1-2/h4-6,8-13H,2-3,7H2,1H3;3*1-2H3 |
| InChIKey | LTSSGTAGYIQREF-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-phenylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-phenylbenzene;ethane?
The IUPAC name of 1-butyl-4-phenylbenzene;ethane (CID 143743409) is 1-butyl-4-phenylbenzene;ethane.
What is the SMILES notation for 1-butyl-4-phenylbenzene;ethane?
The canonical SMILES for 1-butyl-4-phenylbenzene;ethane is CC.CC.CC.CCCCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-butyl-4-phenylbenzene;ethane?
The InChIKey is LTSSGTAGYIQREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.3C2H6/c1-2-3-7-14-10-12-16(13-11-14)15-8-5-4-6-9-15;3*1-2/h4-6,8-13H,2-3,7H2,1H3;3*1-2H3.
What are the key properties of 1-butyl-4-phenylbenzene;ethane?
1-butyl-4-phenylbenzene;ethane has a molecular weight of 300.53 g/mol, XLogP of 7.77, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-phenylbenzene;ethane is sourced from PubChem (CID 143743409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).