C24H24N2O2 — CID 4296967
4-butyl-N'-(4-phenylbenzoyl)benzohydrazide (PubChem CID 4296967) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-butyl-N'-(4-phenylbenzoyl)benzohydrazide.
| Compound Name | 4-butyl-N'-(4-phenylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 4296967 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-butyl-N'-(4-phenylbenzoyl)benzohydrazide |
| SMILES | CCCCc1ccc(C(=O)NNC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-2-3-7-18-10-12-21(13-11-18)23(27)25-26-24(28)22-16-14-20(15-17-22)19-8-5-4-6-9-19/h4-6,8-17H,2-3,7H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | RASSDXBNIKOAAX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|