C16H19N3O2 — CID 8968206
N'-(4-butylbenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 8968206) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N'-(4-butylbenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(4-butylbenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 8968206 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N'-(4-butylbenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | CCCCc1ccc(C(=O)NNC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-3-5-12-7-9-13(10-8-12)15(20)18-19-16(21)14-6-4-11-17-14/h4,6-11,17H,2-3,5H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | QYXBXSLHXGMDDY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|