C18H22N2O3 — CID 6733621
N'-(4-hexylbenzoyl)furan-2-carbohydrazide (PubChem CID 6733621) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N'-(4-hexylbenzoyl)furan-2-carbohydrazide.
| Compound Name | N'-(4-hexylbenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 6733621 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-(4-hexylbenzoyl)furan-2-carbohydrazide |
| SMILES | CCCCCCc1ccc(C(=O)NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-3-4-5-7-14-9-11-15(12-10-14)17(21)19-20-18(22)16-8-6-13-23-16/h6,8-13H,2-5,7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | JKTKOLGLCFWAEP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|