C10H15N3O3 — CID 4642065
1-butyl-3-(furan-2-carbonylamino)urea (PubChem CID 4642065) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-butyl-3-(furan-2-carbonylamino)urea.
| Compound Name | 1-butyl-3-(furan-2-carbonylamino)urea |
|---|---|
| PubChem CID | 4642065 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-butyl-3-(furan-2-carbonylamino)urea |
| SMILES | CCCCNC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C10H15N3O3/c1-2-3-6-11-10(15)13-12-9(14)8-5-4-7-16-8/h4-5,7H,2-3,6H2,1H3,(H,12,14)(H2,11,13,15) |
| InChIKey | ASMAKRYUVXHWPZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|