C18H30N2O2S — CID 10958704
N-(dodecylcarbamothioyl)furan-2-carboxamide (PubChem CID 10958704) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is N-(dodecylcarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(dodecylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 10958704 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(dodecylcarbamothioyl)furan-2-carboxamide |
| SMILES | CCCCCCCCCCCCNC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H30N2O2S/c1-2-3-4-5-6-7-8-9-10-11-14-19-18(23)20-17(21)16-13-12-15-22-16/h12-13,15H,2-11,14H2,1H3,(H2,19,20,21,23) |
| InChIKey | IQVHOTIIAULJLN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|