C11H16N2OS2 — CID 19187814
N-(pentylcarbamothioyl)thiophene-2-carboxamide (PubChem CID 19187814) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is N-(pentylcarbamothioyl)thiophene-2-carboxamide.
| Compound Name | N-(pentylcarbamothioyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19187814 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(pentylcarbamothioyl)thiophene-2-carboxamide |
| SMILES | CCCCCNC(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C11H16N2OS2/c1-2-3-4-7-12-11(15)13-10(14)9-6-5-8-16-9/h5-6,8H,2-4,7H2,1H3,(H2,12,13,14,15) |
| InChIKey | ZVEPGNXSIJDXKL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|