C19H24N2O2S2 — CID 4951604
N-[(4-heptoxyphenyl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 4951604) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[(4-heptoxyphenyl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4951604 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[(4-heptoxyphenyl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H24N2O2S2/c1-2-3-4-5-6-13-23-16-11-9-15(10-12-16)20-19(24)21-18(22)17-8-7-14-25-17/h7-12,14H,2-6,13H2,1H3,(H2,20,21,22,24) |
| InChIKey | RFTGAIQFDVCFGF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|