C19H30N2O2S — CID 4951646
N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 4951646) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4951646 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2S/c1-5-6-7-8-9-14-23-16-12-10-15(11-13-16)20-18(24)21-17(22)19(2,3)4/h10-13H,5-9,14H2,1-4H3,(H2,20,21,22,24) |
| InChIKey | RHRSSLYICUUEQZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|