C29H42N2O3S — CID 54784310
5-(2,5-dimethylphenoxy)-N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpentanamide (PubChem CID 54784310) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54784310 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[(4-heptoxyphenyl)carbamothioyl]-2,2-dimethylpentanamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C29H42N2O3S/c1-6-7-8-9-10-19-33-25-16-14-24(15-17-25)30-28(35)31-27(32)29(4,5)18-11-20-34-26-21-22(2)12-13-23(26)3/h12-17,21H,6-11,18-20H2,1-5H3,(H2,30,31,32,35) |
| InChIKey | QBGDZIPOLOMDIE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|