C26H35N3O3S — CID 54784258
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]pentanamide (PubChem CID 54784258) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784258 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[3-(2-methylpropanoylamino)phenyl]carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2cccc(NC(=O)C(C)C)c2)c1 |
| InChI | InChI=1S/C26H35N3O3S/c1-17(2)23(30)27-20-9-7-10-21(16-20)28-25(33)29-24(31)26(5,6)13-8-14-32-22-15-18(3)11-12-19(22)4/h7,9-12,15-17H,8,13-14H2,1-6H3,(H,27,30)(H2,28,29,31,33) |
| InChIKey | DQIPPFFHYDRWHU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|