C30H35N3O3S — CID 54784193
N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide (PubChem CID 54784193) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide.
| Compound Name | N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 54784193 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]carbamothioylamino]benzamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2cccc(C(=O)NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H35N3O3S/c1-21-14-15-22(2)26(18-21)36-17-9-16-30(3,4)28(35)33-29(37)32-25-13-8-12-24(19-25)27(34)31-20-23-10-6-5-7-11-23/h5-8,10-15,18-19H,9,16-17,20H2,1-4H3,(H,31,34)(H2,32,33,35,37) |
| InChIKey | BLWYJWYADOHVQP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|