C30H36N2O3 — CID 54783734
N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-N-methylbenzamide (PubChem CID 54783734) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54783734 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-benzyl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-N-methylbenzamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2cccc(C(=O)N(C)Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H36N2O3/c1-22-15-16-23(2)27(19-22)35-18-10-17-30(3,4)29(34)31-26-14-9-13-25(20-26)28(33)32(5)21-24-11-7-6-8-12-24/h6-9,11-16,19-20H,10,17-18,21H2,1-5H3,(H,31,34) |
| InChIKey | XGFRFIVYPFCYSB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|