C26H36N2O3 — CID 54783884
N-butan-2-yl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]benzamide (PubChem CID 54783884) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-butan-2-yl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]benzamide.
| Compound Name | N-butan-2-yl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]benzamide |
|---|---|
| PubChem CID | 54783884 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-butan-2-yl-3-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-7-20(4)27-24(29)21-10-8-11-22(17-21)28-25(30)26(5,6)14-9-15-31-23-16-18(2)12-13-19(23)3/h8,10-13,16-17,20H,7,9,14-15H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | FDVLIKCMOHEETH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|