C24H31NO3 — CID 54783872
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(3-prop-2-enoxyphenyl)pentanamide (PubChem CID 54783872) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(3-prop-2-enoxyphenyl)pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(3-prop-2-enoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 54783872 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(3-prop-2-enoxyphenyl)pentanamide |
| SMILES | C=CCOc1cccc(NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H31NO3/c1-6-14-27-21-10-7-9-20(17-21)25-23(26)24(4,5)13-8-15-28-22-16-18(2)11-12-19(22)3/h6-7,9-12,16-17H,1,8,13-15H2,2-5H3,(H,25,26) |
| InChIKey | XYUFLZIYRPULKK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|