C28H38N2O3 — CID 54783710
N-[3-(azepane-1-carbonyl)phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 54783710) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is N-[3-(azepane-1-carbonyl)phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[3-(azepane-1-carbonyl)phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783710 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | N-[3-(azepane-1-carbonyl)phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2cccc(C(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C28H38N2O3/c1-21-13-14-22(2)25(19-21)33-18-10-15-28(3,4)27(32)29-24-12-9-11-23(20-24)26(31)30-16-7-5-6-8-17-30/h9,11-14,19-20H,5-8,10,15-18H2,1-4H3,(H,29,32) |
| InChIKey | JWSNUAPSNRUKPW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|