C31H40N2O3 — CID 142457535
N-[1-[3,4-bis(ethenyl)benzoyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 142457535) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is N-[1-[3,4-bis(ethenyl)benzoyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[1-[3,4-bis(ethenyl)benzoyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 142457535 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | N-[1-[3,4-bis(ethenyl)benzoyl]piperidin-4-yl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | C=Cc1ccc(C(=O)N2CCC(NC(=O)C(C)(C)CCCOc3cc(C)ccc3C)CC2)cc1C=C |
| InChI | InChI=1S/C31H40N2O3/c1-7-24-12-13-26(21-25(24)8-2)29(34)33-17-14-27(15-18-33)32-30(35)31(5,6)16-9-19-36-28-20-22(3)10-11-23(28)4/h7-8,10-13,20-21,27H,1-2,9,14-19H2,3-6H3,(H,32,35) |
| InChIKey | SDEJRBNBIKFQJY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|