C26H35ClN2O3 — CID 175209525
N-[4-[(5-chloro-3-pyridinyl)oxy]cyclohexyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 175209525) has the molecular formula C26H35ClN2O3 and a molecular weight of 459.03 g/mol. Its IUPAC name is N-[4-[(5-chloro-3-pyridinyl)oxy]cyclohexyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[4-[(5-chloro-3-pyridinyl)oxy]cyclohexyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 175209525 |
| Molecular Formula | C26H35ClN2O3 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-[4-[(5-chloro-3-pyridinyl)oxy]cyclohexyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC2CCC(Oc3cncc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C26H35ClN2O3/c1-18-6-7-19(2)24(14-18)31-13-5-12-26(3,4)25(30)29-21-8-10-22(11-9-21)32-23-15-20(27)16-28-17-23/h6-7,14-17,21-22H,5,8-13H2,1-4H3,(H,29,30) |
| InChIKey | DPBFUXOFBCOERH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|