C17H27NO2 — CID 54783886
5-(2,5-dimethylphenoxy)-N-ethyl-2,2-dimethylpentanamide (PubChem CID 54783886) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-ethyl-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-ethyl-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783886 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-ethyl-2,2-dimethylpentanamide |
| SMILES | CCNC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C17H27NO2/c1-6-18-16(19)17(4,5)10-7-11-20-15-12-13(2)8-9-14(15)3/h8-9,12H,6-7,10-11H2,1-5H3,(H,18,19) |
| InChIKey | SVFNVSVIJLGZFZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|