C24H31NO4 — CID 158479808
5-(2,5-dimethylphenoxy)-N-[2-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-2,2-dimethylpentanamide (PubChem CID 158479808) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[2-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[2-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 158479808 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[2-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NCC(=O)c2ccc(O)c(C)c2)c1 |
| InChI | InChI=1S/C24H31NO4/c1-16-7-8-17(2)22(13-16)29-12-6-11-24(4,5)23(28)25-15-21(27)19-9-10-20(26)18(3)14-19/h7-10,13-14,26H,6,11-12,15H2,1-5H3,(H,25,28) |
| InChIKey | ZYCFGKIEBRHFJI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|