C29H32N2O6 — CID 139518679
[4-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]acetyl]-2-hydroxyphenyl] pyridine-3-carboxylate (PubChem CID 139518679) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is [4-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]acetyl]-2-hydroxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]acetyl]-2-hydroxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139518679 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [4-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]acetyl]-2-hydroxyphenyl] pyridine-3-carboxylate |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NCC(=O)c2ccc(OC(=O)c3cccnc3)c(O)c2)c1 |
| InChI | InChI=1S/C29H32N2O6/c1-19-8-9-20(2)26(15-19)36-14-6-12-29(3,4)28(35)31-18-24(33)21-10-11-25(23(32)16-21)37-27(34)22-7-5-13-30-17-22/h5,7-11,13,15-17,32H,6,12,14,18H2,1-4H3,(H,31,35) |
| InChIKey | AWRXORKYXKZKLP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|