C21H36N2O2 — CID 54783817
N-[2-(diethylamino)ethyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 54783817) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783817 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | CCN(CC)CCNC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C21H36N2O2/c1-7-23(8-2)14-13-22-20(24)21(5,6)12-9-15-25-19-16-17(3)10-11-18(19)4/h10-11,16H,7-9,12-15H2,1-6H3,(H,22,24) |
| InChIKey | KEQIBRQHDXKFGW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|