C44H69N3O3 — CID 67093867
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[3-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]ethyl-ethylamino]propyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 67093867) has the molecular formula C44H69N3O3 and a molecular weight of 688.05 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[3-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]ethyl-ethylamino]propyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[3-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]ethyl-ethylamino]propyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 67093867 |
| Molecular Formula | C44H69N3O3 |
| Molecular Weight | 688.05 g/mol |
| Exact Mass | 687.53 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[3-[2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]ethyl-ethylamino]propyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCN(CC)CCNC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C44H69N3O3/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-29-42(48)45-33-28-35-47(8-2)36-34-46-43(49)44(5,6)32-27-37-50-41-38-39(3)30-31-40(41)4/h9-10,12-13,15-16,18-19,21-22,24-25,30-31,38H,7-8,11,14,17,20,23,26-29,32-37H2,1-6H3,(H,45,48)(H,46,49)/b10-9-,13-12-,16-15-,19-18-,22-21-,25-24- |
| InChIKey | SEUISBMASWUFNT-SDEDJGNESA-N |
| XLogP | 9.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.05 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|