C41H60N2O5 — CID 67093709
methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoate (PubChem CID 67093709) has the molecular formula C41H60N2O5 and a molecular weight of 660.94 g/mol. Its IUPAC name is methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoate.
| Compound Name | methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoate |
|---|---|
| PubChem CID | 67093709 |
| Molecular Formula | C41H60N2O5 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-3-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCC(NC(=O)C(C)(C)CCCOc1cc(C)ccc1C)C(=O)OC |
| InChI | InChI=1S/C41H60N2O5/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27-38(44)42-33-36(39(45)47-6)43-40(46)41(4,5)30-26-31-48-37-32-34(2)28-29-35(37)3/h8-9,11-12,14-15,17-18,20-21,23-24,28-29,32,36H,7,10,13,16,19,22,25-27,30-31,33H2,1-6H3,(H,42,44)(H,43,46)/b9-8-,12-11-,15-14-,18-17-,21-20-,24-23- |
| InChIKey | SWWVQKYPNSNGSJ-MMRRFZAGSA-N |
| XLogP | 8.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|