C20H27NO3 — CID 54783499
5-(2,5-dimethylphenoxy)-N-(furan-2-ylmethyl)-2,2-dimethylpentanamide (PubChem CID 54783499) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-(furan-2-ylmethyl)-2,2-dimethylpentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-(furan-2-ylmethyl)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783499 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-(furan-2-ylmethyl)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C20H27NO3/c1-15-8-9-16(2)18(13-15)24-12-6-10-20(3,4)19(22)21-14-17-7-5-11-23-17/h5,7-9,11,13H,6,10,12,14H2,1-4H3,(H,21,22) |
| InChIKey | ZDRGTORINCCMNR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|