C21H26BrNO2 — CID 54783495
N-(4-bromophenyl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 54783495) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-(4-bromophenyl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783495 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-(4-bromophenyl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H26BrNO2/c1-15-6-7-16(2)19(14-15)25-13-5-12-21(3,4)20(24)23-18-10-8-17(22)9-11-18/h6-11,14H,5,12-13H2,1-4H3,(H,23,24) |
| InChIKey | VKZOHMBBMCFFLA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|