C23H29NO4 — CID 70410381
2-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]acetic acid (PubChem CID 70410381) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 70410381 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]acetic acid |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H29NO4/c1-16-6-7-17(2)20(14-16)28-13-5-12-23(3,4)22(27)24-19-10-8-18(9-11-19)15-21(25)26/h6-11,14H,5,12-13,15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | CGDMZQRCWZGCQQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|