C24H31NO4 — CID 70409817
3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]propanoic acid (PubChem CID 70409817) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70409817 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 3-[4-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]phenyl]propanoic acid |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H31NO4/c1-17-6-7-18(2)21(16-17)29-15-5-14-24(3,4)23(28)25-20-11-8-19(9-12-20)10-13-22(26)27/h6-9,11-12,16H,5,10,13-15H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | IVAUJGBYAXHVLL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|