C31H38N2O3S — CID 54784326
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]pentanamide (PubChem CID 54784326) has the molecular formula C31H38N2O3S and a molecular weight of 518.72 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784326 |
| Molecular Formula | C31H38N2O3S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(OCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H38N2O3S/c1-23-13-14-24(2)28(22-23)36-21-9-19-31(3,4)29(34)33-30(37)32-26-15-17-27(18-16-26)35-20-8-12-25-10-6-5-7-11-25/h5-7,10-11,13-18,22H,8-9,12,19-21H2,1-4H3,(H2,32,33,34,37) |
| InChIKey | LWHCQWZRWQEUSM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|