C25H34N2O3S — CID 54784338
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-propan-2-yloxyphenyl)carbamothioyl]pentanamide (PubChem CID 54784338) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-propan-2-yloxyphenyl)carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-propan-2-yloxyphenyl)carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784338 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[(4-propan-2-yloxyphenyl)carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C25H34N2O3S/c1-17(2)30-21-12-10-20(11-13-21)26-24(31)27-23(28)25(5,6)14-7-15-29-22-16-18(3)8-9-19(22)4/h8-13,16-17H,7,14-15H2,1-6H3,(H2,26,27,28,31) |
| InChIKey | GCTXLCOKLVQYAU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|